C7H5F7 — CID 175084133
1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclobutene (PubChem CID 175084133) has the molecular formula C7H5F7 and a molecular weight of 222.10 g/mol. Its IUPAC name is 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclobutene.
| Compound Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclobutene |
|---|---|
| PubChem CID | 175084133 |
| Molecular Formula | C7H5F7 |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 1-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclobutene |
| SMILES | FC(F)(F)C(F)(C1=CCC1)C(F)(F)F |
| InChI | InChI=1S/C7H5F7/c8-5(6(9,10)11,7(12,13)14)4-2-1-3-4/h2H,1,3H2 |
| InChIKey | GLPCRMHRFXPFNO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|