C24H30N4S — CID 175084157
N-(1-adamantyl)-5-[(1S,9S)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-1,3,4-thiadiazol-2-amine (PubChem CID 175084157) has the molecular formula C24H30N4S and a molecular weight of 406.60 g/mol. Its IUPAC name is N-(1-adamantyl)-5-[(1S,9S)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(1-adamantyl)-5-[(1S,9S)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 175084157 |
| Molecular Formula | C24H30N4S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | N-(1-adamantyl)-5-[(1S,9S)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-1,3,4-thiadiazol-2-amine |
| SMILES | CC1(C)[C@@H]2Cc3cc(-c4nnc(NC56CC7CC(CC(C7)C5)C6)s4)ncc3[C@H]1C2 |
| InChI | InChI=1S/C24H30N4S/c1-23(2)17-6-16-7-20(25-12-18(16)19(23)8-17)21-27-28-22(29-21)26-24-9-13-3-14(10-24)5-15(4-13)11-24/h7,12-15,17,19H,3-6,8-11H2,1-2H3,(H,26,28)/t13?,14?,15?,17-,19-,24?/m1/s1 |
| InChIKey | TZUZRNPAWNZKHR-AQIXVEALSA-N |
| XLogP | 5.67 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |