About gold(1+);imidazol-3-ide;pyridine
gold(1+);imidazol-3-ide;pyridine (PubChem CID 175084424) has the molecular formula C8H8AuN3
and a molecular weight of 343.14 g/mol. Its IUPAC name is gold(1+);imidazol-3-ide;pyridine.
Molecular Properties
| Compound Name | gold(1+);imidazol-3-ide;pyridine |
| PubChem CID | 175084424 |
| Molecular Formula | C8H8AuN3 |
| Molecular Weight | 343.14 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | gold(1+);imidazol-3-ide;pyridine |
| SMILES | [Au+].c1c[n-]cn1.c1ccncc1 |
| InChI | InChI=1S/C5H5N.C3H3N2.Au/c1-2-4-6-5-3-1;1-2-5-3-4-1;/h1-5H;1-3H;/q;-1;+1 |
| InChIKey | MPFAJWNCXSZYBB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze gold(1+);imidazol-3-ide;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);imidazol-3-ide;pyridine?
The IUPAC name of gold(1+);imidazol-3-ide;pyridine (CID 175084424) is gold(1+);imidazol-3-ide;pyridine.
What is the SMILES notation for gold(1+);imidazol-3-ide;pyridine?
The canonical SMILES for gold(1+);imidazol-3-ide;pyridine is [Au+].c1c[n-]cn1.c1ccncc1.
What is the InChIKey of gold(1+);imidazol-3-ide;pyridine?
The InChIKey is MPFAJWNCXSZYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N.C3H3N2.Au/c1-2-4-6-5-3-1;1-2-5-3-4-1;/h1-5H;1-3H;/q;-1;+1.
What are the key properties of gold(1+);imidazol-3-ide;pyridine?
gold(1+);imidazol-3-ide;pyridine has a molecular weight of 343.14 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);imidazol-3-ide;pyridine is sourced from PubChem (CID 175084424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).