About 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide
5-methyl-N,2,3,4-tetramethylidenehex-5-enamide (PubChem CID 175084526) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide.
Molecular Properties
| Compound Name | 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide |
| PubChem CID | 175084526 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide |
| SMILES | C=NC(=O)C(=C)C(=C)C(=C)C(=C)C |
| InChI | InChI=1S/C11H13NO/c1-7(2)8(3)9(4)10(5)11(13)12-6/h1,3-6H2,2H3 |
| InChIKey | WGMHLNWOJVEQDQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide?
The IUPAC name of 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide (CID 175084526) is 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide.
What is the SMILES notation for 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide?
The canonical SMILES for 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide is C=NC(=O)C(=C)C(=C)C(=C)C(=C)C.
What is the InChIKey of 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide?
The InChIKey is WGMHLNWOJVEQDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-7(2)8(3)9(4)10(5)11(13)12-6/h1,3-6H2,2H3.
What are the key properties of 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide?
5-methyl-N,2,3,4-tetramethylidenehex-5-enamide has a molecular weight of 175.23 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N,2,3,4-tetramethylidenehex-5-enamide is sourced from PubChem (CID 175084526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).