C34H35N7O6 — CID 175085532
N-[3-[1-[(2R,3R)-2-formyl-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl]triazol-4-yl]phenyl]-6,7-bis(2-methoxyethoxy)quinazoline-4-carboxamide (PubChem CID 175085532) has the molecular formula C34H35N7O6 and a molecular weight of 637.70 g/mol. Its IUPAC name is N-[3-[1-[(2R,3R)-2-formyl-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl]triazol-4-yl]phenyl]-6,7-bis(2-methoxyethoxy)quinazoline-4-carboxamide.
| Compound Name | N-[3-[1-[(2R,3R)-2-formyl-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl]triazol-4-yl]phenyl]-6,7-bis(2-methoxyethoxy)quinazoline-4-carboxamide |
|---|---|
| PubChem CID | 175085532 |
| Molecular Formula | C34H35N7O6 |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | N-[3-[1-[(2R,3R)-2-formyl-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl]triazol-4-yl]phenyl]-6,7-bis(2-methoxyethoxy)quinazoline-4-carboxamide |
| SMILES | COCCOc1cc2ncnc(C(=O)Nc3cccc(-c4cn([C@@H]5CCc6ccccc6N[C@H]5C=O)nn4)c3)c2cc1OCCOC |
| InChI | InChI=1S/C34H35N7O6/c1-44-12-14-46-31-17-25-27(18-32(31)47-15-13-45-2)35-21-36-33(25)34(43)37-24-8-5-7-23(16-24)28-19-41(40-39-28)30-11-10-22-6-3-4-9-26(22)38-29(30)20-42/h3-9,16-21,29-30,38H,10-15H2,1-2H3,(H,37,43)/t29-,30+/m0/s1 |
| InChIKey | GILKFYQVDHMXPM-XZWHSSHBSA-N |
| XLogP | 4.36 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|