About piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate
piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate (PubChem CID 175085561) has the molecular formula C11H14ClN3O2
and a molecular weight of 255.70 g/mol. Its IUPAC name is piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate.
Molecular Properties
| Compound Name | piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate |
| PubChem CID | 175085561 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate |
| SMILES | O=C(OCC1CCNCC1)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C11H14ClN3O2/c12-10-2-1-9(14-15-10)11(16)17-7-8-3-5-13-6-4-8/h1-2,8,13H,3-7H2 |
| InChIKey | VUWICYWGUDNJHY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate?
The IUPAC name of piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate (CID 175085561) is piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate.
What is the SMILES notation for piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate?
The canonical SMILES for piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate is O=C(OCC1CCNCC1)c1ccc(Cl)nn1.
What is the InChIKey of piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate?
The InChIKey is VUWICYWGUDNJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN3O2/c12-10-2-1-9(14-15-10)11(16)17-7-8-3-5-13-6-4-8/h1-2,8,13H,3-7H2.
What are the key properties of piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate?
piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate has a molecular weight of 255.70 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylmethyl 6-chloropyridazine-3-carboxylate is sourced from PubChem (CID 175085561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).