C11H7F13 — CID 175085744
1-[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]cyclopentene (PubChem CID 175085744) has the molecular formula C11H7F13 and a molecular weight of 386.15 g/mol. Its IUPAC name is 1-[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]cyclopentene.
| Compound Name | 1-[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]cyclopentene |
|---|---|
| PubChem CID | 175085744 |
| Molecular Formula | C11H7F13 |
| Molecular Weight | 386.15 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 1-[1,1,1,3,3,4,4,5,5,5-decafluoro-2-(trifluoromethyl)pentan-2-yl]cyclopentene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(C1=CCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H7F13/c12-7(13,8(14,15)11(22,23)24)6(9(16,17)18,10(19,20)21)5-3-1-2-4-5/h3H,1-2,4H2 |
| InChIKey | BSMFFGNLOLTFCP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.15 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|