About 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine
3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine (PubChem CID 175085870) has the molecular formula C15H16N2S2
and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine |
| PubChem CID | 175085870 |
| Molecular Formula | C15H16N2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine |
| SMILES | NC=C(N)C(SS)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2S2/c16-11-14(17)15(19-18,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,18H,16-17H2 |
| InChIKey | CDSXNUWLBDYPJW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine?
The IUPAC name of 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine (CID 175085870) is 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine.
What is the SMILES notation for 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine?
The canonical SMILES for 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine is NC=C(N)C(SS)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine?
The InChIKey is CDSXNUWLBDYPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2S2/c16-11-14(17)15(19-18,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,18H,16-17H2.
What are the key properties of 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine?
3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine has a molecular weight of 288.44 g/mol, XLogP of 3.27, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(disulfanyl)-3,3-diphenylprop-1-ene-1,2-diamine is sourced from PubChem (CID 175085870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).