C11H14N2O5 — CID 175086037
1-hydroxy-3-[2-(methylamino)ethyl]indole-2,4,5,6-tetrol (PubChem CID 175086037) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 1-hydroxy-3-[2-(methylamino)ethyl]indole-2,4,5,6-tetrol.
| Compound Name | 1-hydroxy-3-[2-(methylamino)ethyl]indole-2,4,5,6-tetrol |
|---|---|
| PubChem CID | 175086037 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-hydroxy-3-[2-(methylamino)ethyl]indole-2,4,5,6-tetrol |
| SMILES | CNCCc1c(O)n(O)c2cc(O)c(O)c(O)c12 |
| InChI | InChI=1S/C11H14N2O5/c1-12-3-2-5-8-6(13(18)11(5)17)4-7(14)9(15)10(8)16/h4,12,14-18H,2-3H2,1H3 |
| InChIKey | JRVDXTHYSAVAMF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|