About 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole)
2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole) (PubChem CID 175086660) has the molecular formula C21H17N5O2
and a molecular weight of 371.40 g/mol. Its IUPAC name is 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole).
Molecular Properties
| Compound Name | 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole) |
| PubChem CID | 175086660 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole) |
| SMILES | c1cncc(-c2cccnc2-c2cccnc2)c1.c1cocn1.c1cocn1 |
| InChI | InChI=1S/C15H11N3.2C3H3NO/c1-4-12(10-16-7-1)14-6-3-9-18-15(14)13-5-2-8-17-11-13;2*1-2-5-3-4-1/h1-11H;2*1-3H |
| InChIKey | IYQKNUOJVOAROI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole)?
The IUPAC name of 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole) (CID 175086660) is 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole).
What is the SMILES notation for 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole)?
The canonical SMILES for 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole) is c1cncc(-c2cccnc2-c2cccnc2)c1.c1cocn1.c1cocn1.
What is the InChIKey of 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole)?
The InChIKey is IYQKNUOJVOAROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3.2C3H3NO/c1-4-12(10-16-7-1)14-6-3-9-18-15(14)13-5-2-8-17-11-13;2*1-2-5-3-4-1/h1-11H;2*1-3H.
What are the key properties of 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole)?
2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole) has a molecular weight of 371.40 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipyridin-3-ylpyridine;bis(1,3-oxazole) is sourced from PubChem (CID 175086660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).