C24H38N4O5Si — CID 175086708
[(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[5-(cyanomethyl)-2-nitrophenyl]pyrrolidin-3-yl] N-tert-butylcarbamate (PubChem CID 175086708) has the molecular formula C24H38N4O5Si and a molecular weight of 490.68 g/mol. Its IUPAC name is [(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[5-(cyanomethyl)-2-nitrophenyl]pyrrolidin-3-yl] N-tert-butylcarbamate.
| Compound Name | [(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[5-(cyanomethyl)-2-nitrophenyl]pyrrolidin-3-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175086708 |
| Molecular Formula | C24H38N4O5Si |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [(3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-[5-(cyanomethyl)-2-nitrophenyl]pyrrolidin-3-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)N(c2cc(CC#N)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C24H38N4O5Si/c1-23(2,3)26-22(29)33-19-14-18(16-32-34(7,8)24(4,5)6)27(15-19)21-13-17(11-12-25)9-10-20(21)28(30)31/h9-10,13,18-19H,11,14-16H2,1-8H3,(H,26,29)/t18-,19-/m0/s1 |
| InChIKey | QXOOOFDSAXLTNX-OALUTQOASA-N |
| XLogP | 5.15 |
| TPSA | 117.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|