About 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole
2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole (PubChem CID 175088959) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole |
| PubChem CID | 175088959 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole |
| SMILES | C1=NN(ON2CCC=N2)CC1 |
| InChI | InChI=1S/C6H10N4O/c1-3-7-9(5-1)11-10-6-2-4-8-10/h3-4H,1-2,5-6H2 |
| InChIKey | NVEBVUZBEQRMSV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole?
The IUPAC name of 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole (CID 175088959) is 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole.
What is the SMILES notation for 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole?
The canonical SMILES for 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole is C1=NN(ON2CCC=N2)CC1.
What is the InChIKey of 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole?
The InChIKey is NVEBVUZBEQRMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-3-7-9(5-1)11-10-6-2-4-8-10/h3-4H,1-2,5-6H2.
What are the key properties of 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole?
2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole has a molecular weight of 154.17 g/mol, XLogP of 0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydropyrazol-2-yloxy)-3,4-dihydropyrazole is sourced from PubChem (CID 175088959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).