C18H24ClN3O6 — CID 175088992
diethyl 2-[[5-[(2-chloroacetyl)amino]-3-methylpyridine-2-carbonyl]amino]pentanedioate (PubChem CID 175088992) has the molecular formula C18H24ClN3O6 and a molecular weight of 413.86 g/mol. Its IUPAC name is diethyl 2-[[5-[(2-chloroacetyl)amino]-3-methylpyridine-2-carbonyl]amino]pentanedioate.
| Compound Name | diethyl 2-[[5-[(2-chloroacetyl)amino]-3-methylpyridine-2-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 175088992 |
| Molecular Formula | C18H24ClN3O6 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | diethyl 2-[[5-[(2-chloroacetyl)amino]-3-methylpyridine-2-carbonyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1ncc(NC(=O)CCl)cc1C)C(=O)OCC |
| InChI | InChI=1S/C18H24ClN3O6/c1-4-27-15(24)7-6-13(18(26)28-5-2)22-17(25)16-11(3)8-12(10-20-16)21-14(23)9-19/h8,10,13H,4-7,9H2,1-3H3,(H,21,23)(H,22,25) |
| InChIKey | QAGMXLDTVAGBBD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|