2-(2,2-diethylhydrazinyl)propanoic acid

C7H16N2O2 — CID 175089566

IUPAC2-(2,2-diethylhydrazinyl)propanoic acid
SMILESCCN(CC)NC(C)C(=O)O
InChIInChI=1S/C7H16N2O2/c1-4-9(5-2)8-6(3)7(10)11/h6,8H,4-5H2,1-3H3,(H,10,11)
InChIKeyCRNNFTGBKYDEKC-UHFFFAOYSA-N
MW160.22 g/mol
LogP0.31
Rot. Bonds5

About 2-(2,2-diethylhydrazinyl)propanoic acid

2-(2,2-diethylhydrazinyl)propanoic acid (PubChem CID 175089566) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-(2,2-diethylhydrazinyl)propanoic acid.

Molecular Properties

Compound Name2-(2,2-diethylhydrazinyl)propanoic acid
PubChem CID175089566
Molecular FormulaC7H16N2O2
Molecular Weight160.22 g/mol
Exact Mass160.12
IUPAC Name2-(2,2-diethylhydrazinyl)propanoic acid
SMILESCCN(CC)NC(C)C(=O)O
InChIInChI=1S/C7H16N2O2/c1-4-9(5-2)8-6(3)7(10)11/h6,8H,4-5H2,1-3H3,(H,10,11)
InChIKeyCRNNFTGBKYDEKC-UHFFFAOYSA-N
XLogP0.31
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.22
LogP ≤ 50.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(2,2-diethylhydrazinyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-[[ethyl(methyl)carbamoyl]amino]propanoic acid
CID 61194675
(2S)-2-[[ethyl(propan-2-yl)carbamoyl]amino]propanoic acid
CID 61196762
2-(3-methylpentan-3-ylamino)propanoic acid
CID 103829131
(2R)-2-(ethylamino)propanoic acid;hydrochloride
CID 87428202
(2S)-2-[2-(diethylamino)ethylcarbamoylamino]propanoic acid
CID 61184562
(2R)-2-[[ethyl(3-hydroxypropyl)carbamoyl]amino]propanoic acid
CID 104861849
(2S)-2-[[(1S)-1-carboxyethyl]amino]propanoic acid
CID 10953819
(2R)-2-[2-[(1S)-1-carboxyethyl]hydrazinyl]propanoic acid
CID 25136606
(2R)-2-[[(2S)-butan-2-yl]amino]propanoic acid
CID 93054816
(2R)-2-[[propan-2-yl(propyl)carbamoyl]amino]propanoic acid
CID 78972056
2-[[2-[ethyl(2-hydroxyethyl)amino]-2-methylpropanoyl]amino]propanoic acid
CID 82041810
2-[[3-(diethylamino)propyl-ethylcarbamoyl]amino]propanoic acid
CID 102995511

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-diethylhydrazinyl)propanoic acid?
The IUPAC name of 2-(2,2-diethylhydrazinyl)propanoic acid (CID 175089566) is 2-(2,2-diethylhydrazinyl)propanoic acid.
What is the SMILES notation for 2-(2,2-diethylhydrazinyl)propanoic acid?
The canonical SMILES for 2-(2,2-diethylhydrazinyl)propanoic acid is CCN(CC)NC(C)C(=O)O.
What is the InChIKey of 2-(2,2-diethylhydrazinyl)propanoic acid?
The InChIKey is CRNNFTGBKYDEKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-4-9(5-2)8-6(3)7(10)11/h6,8H,4-5H2,1-3H3,(H,10,11).
What are the key properties of 2-(2,2-diethylhydrazinyl)propanoic acid?
2-(2,2-diethylhydrazinyl)propanoic acid has a molecular weight of 160.22 g/mol, XLogP of 0.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethylhydrazinyl)propanoic acid is sourced from PubChem (CID 175089566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).