C32H33N7O5 — CID 175089678
(3S)-3-[4-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]triazol-1-yl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 175089678) has the molecular formula C32H33N7O5 and a molecular weight of 595.66 g/mol. Its IUPAC name is (3S)-3-[4-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]triazol-1-yl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3S)-3-[4-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]triazol-1-yl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 175089678 |
| Molecular Formula | C32H33N7O5 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (3S)-3-[4-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]triazol-1-yl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | COCCOc1cc2ncnc(Nc3cccc(-c4cn([C@H]5CCc6ccccc6NC5=O)nn4)c3)c2cc1OCCOC |
| InChI | InChI=1S/C32H33N7O5/c1-41-12-14-43-29-17-24-26(18-30(29)44-15-13-42-2)33-20-34-31(24)35-23-8-5-7-22(16-23)27-19-39(38-37-27)28-11-10-21-6-3-4-9-25(21)36-32(28)40/h3-9,16-20,28H,10-15H2,1-2H3,(H,36,40)(H,33,34,35)/t28-/m0/s1 |
| InChIKey | ZCXZDLBPEAJNBV-NDEPHWFRSA-N |
| XLogP | 4.81 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|