C31H24ClFN2OS — CID 175090031
(2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)phenyl]-3-(2-methoxyphenyl)propanethioamide (PubChem CID 175090031) has the molecular formula C31H24ClFN2OS and a molecular weight of 527.06 g/mol. Its IUPAC name is (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)phenyl]-3-(2-methoxyphenyl)propanethioamide.
| Compound Name | (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)phenyl]-3-(2-methoxyphenyl)propanethioamide |
|---|---|
| PubChem CID | 175090031 |
| Molecular Formula | C31H24ClFN2OS |
| Molecular Weight | 527.06 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | (2R)-N-(4-chlorophenyl)-2-[4-(6-fluoroquinolin-4-yl)phenyl]-3-(2-methoxyphenyl)propanethioamide |
| SMILES | COc1ccccc1C[C@@H](C(=S)Nc1ccc(Cl)cc1)c1ccc(-c2ccnc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C31H24ClFN2OS/c1-36-30-5-3-2-4-22(30)18-27(31(37)35-25-13-10-23(32)11-14-25)21-8-6-20(7-9-21)26-16-17-34-29-15-12-24(33)19-28(26)29/h2-17,19,27H,18H2,1H3,(H,35,37)/t27-/m1/s1 |
| InChIKey | QPQCBYGZISCAHG-HHHXNRCGSA-N |
| XLogP | 8.47 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.06 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|