About azane;3,8-dimethylisoquinoline
azane;3,8-dimethylisoquinoline (PubChem CID 175090064) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is azane;3,8-dimethylisoquinoline.
Molecular Properties
| Compound Name | azane;3,8-dimethylisoquinoline |
| PubChem CID | 175090064 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | azane;3,8-dimethylisoquinoline |
| SMILES | Cc1cc2cccc(C)c2cn1.N |
| InChI | InChI=1S/C11H11N.H3N/c1-8-4-3-5-10-6-9(2)12-7-11(8)10;/h3-7H,1-2H3;1H3 |
| InChIKey | CJGJUUKNXTTZEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;3,8-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3,8-dimethylisoquinoline?
The IUPAC name of azane;3,8-dimethylisoquinoline (CID 175090064) is azane;3,8-dimethylisoquinoline.
What is the SMILES notation for azane;3,8-dimethylisoquinoline?
The canonical SMILES for azane;3,8-dimethylisoquinoline is Cc1cc2cccc(C)c2cn1.N.
What is the InChIKey of azane;3,8-dimethylisoquinoline?
The InChIKey is CJGJUUKNXTTZEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.H3N/c1-8-4-3-5-10-6-9(2)12-7-11(8)10;/h3-7H,1-2H3;1H3.
What are the key properties of azane;3,8-dimethylisoquinoline?
azane;3,8-dimethylisoquinoline has a molecular weight of 174.25 g/mol, XLogP of 3.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3,8-dimethylisoquinoline is sourced from PubChem (CID 175090064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).