C13H17N5O4 — CID 175090171
3-(2-amino-5-carbamoyl-7-methoxybenzimidazol-1-yl)propyl carbamate (PubChem CID 175090171) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 3-(2-amino-5-carbamoyl-7-methoxybenzimidazol-1-yl)propyl carbamate.
| Compound Name | 3-(2-amino-5-carbamoyl-7-methoxybenzimidazol-1-yl)propyl carbamate |
|---|---|
| PubChem CID | 175090171 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-(2-amino-5-carbamoyl-7-methoxybenzimidazol-1-yl)propyl carbamate |
| SMILES | COc1cc(C(N)=O)cc2nc(N)n(CCCOC(N)=O)c12 |
| InChI | InChI=1S/C13H17N5O4/c1-21-9-6-7(11(14)19)5-8-10(9)18(12(15)17-8)3-2-4-22-13(16)20/h5-6H,2-4H2,1H3,(H2,14,19)(H2,15,17)(H2,16,20) |
| InChIKey | KVSJKCFAMMTCFB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 148.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|