C30H31NO — CID 175090718
(3S)-3-[[2-tert-butyl-1-(4-methylphenyl)indol-3-yl]methyl]-3-methyl-2H-inden-1-one (PubChem CID 175090718) has the molecular formula C30H31NO and a molecular weight of 421.58 g/mol. Its IUPAC name is (3S)-3-[[2-tert-butyl-1-(4-methylphenyl)indol-3-yl]methyl]-3-methyl-2H-inden-1-one.
| Compound Name | (3S)-3-[[2-tert-butyl-1-(4-methylphenyl)indol-3-yl]methyl]-3-methyl-2H-inden-1-one |
|---|---|
| PubChem CID | 175090718 |
| Molecular Formula | C30H31NO |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (3S)-3-[[2-tert-butyl-1-(4-methylphenyl)indol-3-yl]methyl]-3-methyl-2H-inden-1-one |
| SMILES | Cc1ccc(-n2c(C(C)(C)C)c(C[C@@]3(C)CC(=O)c4ccccc43)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H31NO/c1-20-14-16-21(17-15-20)31-26-13-9-7-10-22(26)24(28(31)29(2,3)4)18-30(5)19-27(32)23-11-6-8-12-25(23)30/h6-17H,18-19H2,1-5H3/t30-/m0/s1 |
| InChIKey | APEFTVQTWWIVIL-PMERELPUSA-N |
| XLogP | 7.32 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |