About 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate
2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate (PubChem CID 175090870) has the molecular formula C7H16N2O5S
and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate |
| PubChem CID | 175090870 |
| Molecular Formula | C7H16N2O5S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate |
| SMILES | CC(C)(C)N(C(=O)OCCO)S(N)(=O)=O |
| InChI | InChI=1S/C7H16N2O5S/c1-7(2,3)9(15(8,12)13)6(11)14-5-4-10/h10H,4-5H2,1-3H3,(H2,8,12,13) |
| InChIKey | VKTWMPMMCDSKMT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate?
The IUPAC name of 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate (CID 175090870) is 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate.
What is the SMILES notation for 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate?
The canonical SMILES for 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate is CC(C)(C)N(C(=O)OCCO)S(N)(=O)=O.
What is the InChIKey of 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate?
The InChIKey is VKTWMPMMCDSKMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O5S/c1-7(2,3)9(15(8,12)13)6(11)14-5-4-10/h10H,4-5H2,1-3H3,(H2,8,12,13).
What are the key properties of 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate?
2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate has a molecular weight of 240.28 g/mol, XLogP of -0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-tert-butyl-N-sulfamoylcarbamate is sourced from PubChem (CID 175090870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).