About 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene
3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene (PubChem CID 175091003) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene.
Molecular Properties
| Compound Name | 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene |
| PubChem CID | 175091003 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene |
| SMILES | C=CCC1(O)CC(=O)OC1=O.C=COC |
| InChI | InChI=1S/C7H8O4.C3H6O/c1-2-3-7(10)4-5(8)11-6(7)9;1-3-4-2/h2,10H,1,3-4H2;3H,1H2,2H3 |
| InChIKey | XRUFYKIXYLJZMW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene?
The IUPAC name of 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene (CID 175091003) is 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene.
What is the SMILES notation for 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene?
The canonical SMILES for 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene is C=CCC1(O)CC(=O)OC1=O.C=COC.
What is the InChIKey of 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene?
The InChIKey is XRUFYKIXYLJZMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4.C3H6O/c1-2-3-7(10)4-5(8)11-6(7)9;1-3-4-2/h2,10H,1,3-4H2;3H,1H2,2H3.
What are the key properties of 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene?
3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene has a molecular weight of 214.22 g/mol, XLogP of 0.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-3-prop-2-enyloxolane-2,5-dione;methoxyethene is sourced from PubChem (CID 175091003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).