About [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate
[(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate (PubChem CID 175091771) has the molecular formula C12H17N3O3
and a molecular weight of 251.29 g/mol. Its IUPAC name is [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate.
Molecular Properties
| Compound Name | [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate |
| PubChem CID | 175091771 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate |
| SMILES | NC(=O)O[C@H]1C[C@@H](CO)N(c2ccccc2N)C1 |
| InChI | InChI=1S/C12H17N3O3/c13-10-3-1-2-4-11(10)15-6-9(18-12(14)17)5-8(15)7-16/h1-4,8-9,16H,5-7,13H2,(H2,14,17)/t8-,9-/m0/s1 |
| InChIKey | SXCGDRSIORRRII-IUCAKERBSA-N |
| XLogP | 0.30 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate?
The IUPAC name of [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate (CID 175091771) is [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate.
What is the SMILES notation for [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate?
The canonical SMILES for [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate is NC(=O)O[C@H]1C[C@@H](CO)N(c2ccccc2N)C1.
What is the InChIKey of [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate?
The InChIKey is SXCGDRSIORRRII-IUCAKERBSA-N. The full InChI is InChI=1S/C12H17N3O3/c13-10-3-1-2-4-11(10)15-6-9(18-12(14)17)5-8(15)7-16/h1-4,8-9,16H,5-7,13H2,(H2,14,17)/t8-,9-/m0/s1.
What are the key properties of [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate?
[(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate has a molecular weight of 251.29 g/mol, XLogP of 0.30, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-1-(2-aminophenyl)-5-(hydroxymethyl)pyrrolidin-3-yl] carbamate is sourced from PubChem (CID 175091771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).