About 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one
1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one (PubChem CID 175092025) has the molecular formula C16H16N4O
and a molecular weight of 280.33 g/mol. Its IUPAC name is 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one.
Molecular Properties
| Compound Name | 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one |
| PubChem CID | 175092025 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one |
| SMILES | CC(=O)Cc1nn[nH]n1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C4H6N4O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3(9)2-4-5-7-8-6-4/h1-10H;2H2,1H3,(H,5,6,7,8) |
| InChIKey | VVWNFKKKGQTQMY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one?
The IUPAC name of 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one (CID 175092025) is 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one.
What is the SMILES notation for 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one?
The canonical SMILES for 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one is CC(=O)Cc1nn[nH]n1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one?
The InChIKey is VVWNFKKKGQTQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C4H6N4O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3(9)2-4-5-7-8-6-4/h1-10H;2H2,1H3,(H,5,6,7,8).
What are the key properties of 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one?
1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one has a molecular weight of 280.33 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;1-(2H-tetrazol-5-yl)propan-2-one is sourced from PubChem (CID 175092025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).