About 2-heptylundecan-1-ol;hexadecanoic acid
2-heptylundecan-1-ol;hexadecanoic acid (PubChem CID 175092135) has the molecular formula C34H70O3
and a molecular weight of 526.93 g/mol. Its IUPAC name is 2-heptylundecan-1-ol;hexadecanoic acid.
Molecular Properties
| Compound Name | 2-heptylundecan-1-ol;hexadecanoic acid |
| PubChem CID | 175092135 |
| Molecular Formula | C34H70O3 |
| Molecular Weight | 526.93 g/mol |
| Exact Mass | 526.53 |
| IUPAC Name | 2-heptylundecan-1-ol;hexadecanoic acid |
| SMILES | CCCCCCCCCC(CO)CCCCCCC.CCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H38O.C16H32O2/c1-3-5-7-9-10-12-14-16-18(17-19)15-13-11-8-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h18-19H,3-17H2,1-2H3;2-15H2,1H3,(H,17,18) |
| InChIKey | QVKWAUFWQJRAKL-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.93 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptylundecan-1-ol;hexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptylundecan-1-ol;hexadecanoic acid?
The IUPAC name of 2-heptylundecan-1-ol;hexadecanoic acid (CID 175092135) is 2-heptylundecan-1-ol;hexadecanoic acid.
What is the SMILES notation for 2-heptylundecan-1-ol;hexadecanoic acid?
The canonical SMILES for 2-heptylundecan-1-ol;hexadecanoic acid is CCCCCCCCCC(CO)CCCCCCC.CCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 2-heptylundecan-1-ol;hexadecanoic acid?
The InChIKey is QVKWAUFWQJRAKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O.C16H32O2/c1-3-5-7-9-10-12-14-16-18(17-19)15-13-11-8-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h18-19H,3-17H2,1-2H3;2-15H2,1H3,(H,17,18).
What are the key properties of 2-heptylundecan-1-ol;hexadecanoic acid?
2-heptylundecan-1-ol;hexadecanoic acid has a molecular weight of 526.93 g/mol, XLogP of 11.65, 29 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptylundecan-1-ol;hexadecanoic acid is sourced from PubChem (CID 175092135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).