About sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate
sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate (PubChem CID 175093232) has the molecular formula C23H41NaO3S
and a molecular weight of 420.64 g/mol. Its IUPAC name is sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate |
| PubChem CID | 175093232 |
| Molecular Formula | C23H41NaO3S |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate |
| SMILES | CCCCCCCCOS(=O)(=O)c1cccc(CC(C)CCCCCC)c1.[H-].[Na+] |
| InChI | InChI=1S/C23H40O3S.Na.H/c1-4-6-8-10-11-13-18-26-27(24,25)23-17-14-16-22(20-23)19-21(3)15-12-9-7-5-2;;/h14,16-17,20-21H,4-13,15,18-19H2,1-3H3;;/q;+1;-1 |
| InChIKey | FFFRLCGMOVFWIY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate?
The IUPAC name of sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate (CID 175093232) is sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate.
What is the SMILES notation for sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate?
The canonical SMILES for sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate is CCCCCCCCOS(=O)(=O)c1cccc(CC(C)CCCCCC)c1.[H-].[Na+].
What is the InChIKey of sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate?
The InChIKey is FFFRLCGMOVFWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40O3S.Na.H/c1-4-6-8-10-11-13-18-26-27(24,25)23-17-14-16-22(20-23)19-21(3)15-12-9-7-5-2;;/h14,16-17,20-21H,4-13,15,18-19H2,1-3H3;;/q;+1;-1.
What are the key properties of sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate?
sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate has a molecular weight of 420.64 g/mol, XLogP of 4.02, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;octyl 3-(2-methyloctyl)benzenesulfonate is sourced from PubChem (CID 175093232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).