C11H14Cl2N2O — CID 175094246
acetamide;5,7-dichloro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 175094246) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is acetamide;5,7-dichloro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | acetamide;5,7-dichloro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 175094246 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | acetamide;5,7-dichloro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CC(N)=O.Clc1cc(Cl)c2c(c1)CNCC2 |
| InChI | InChI=1S/C9H9Cl2N.C2H5NO/c10-7-3-6-5-12-2-1-8(6)9(11)4-7;1-2(3)4/h3-4,12H,1-2,5H2;1H3,(H2,3,4) |
| InChIKey | OPAYAVJBSKDOQO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |