C20H20F6O2 — CID 175094638
5-ethyl-4-(2-ethylphenyl)-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 175094638) has the molecular formula C20H20F6O2 and a molecular weight of 406.37 g/mol. Its IUPAC name is 5-ethyl-4-(2-ethylphenyl)-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 5-ethyl-4-(2-ethylphenyl)-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 175094638 |
| Molecular Formula | C20H20F6O2 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 5-ethyl-4-(2-ethylphenyl)-1-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | CCC1=C(c2ccccc2CC)C=CC(C=O)(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C20H20F6O2/c1-3-13-7-5-6-8-15(13)16-9-10-17(12-27,11-14(16)4-2)18(28,19(21,22)23)20(24,25)26/h5-10,12,28H,3-4,11H2,1-2H3 |
| InChIKey | ZCYBRDYKZBDXFQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|