C28H34N6O3 — CID 175094641
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methyl-5-(6-piperazin-1-yl-3-pyridinyl)benzamide;prop-2-enamide (PubChem CID 175094641) has the molecular formula C28H34N6O3 and a molecular weight of 502.62 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methyl-5-(6-piperazin-1-yl-3-pyridinyl)benzamide;prop-2-enamide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methyl-5-(6-piperazin-1-yl-3-pyridinyl)benzamide;prop-2-enamide |
|---|---|
| PubChem CID | 175094641 |
| Molecular Formula | C28H34N6O3 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-methyl-5-(6-piperazin-1-yl-3-pyridinyl)benzamide;prop-2-enamide |
| SMILES | C=CC(N)=O.Cc1cc(C)c(CNC(=O)c2cc(-c3ccc(N4CCNCC4)nc3)ccc2C)c(=O)[nH]1 |
| InChI | InChI=1S/C25H29N5O2.C3H5NO/c1-16-4-5-19(20-6-7-23(27-14-20)30-10-8-26-9-11-30)13-21(16)24(31)28-15-22-17(2)12-18(3)29-25(22)32;1-2-3(4)5/h4-7,12-14,26H,8-11,15H2,1-3H3,(H,28,31)(H,29,32);2H,1H2,(H2,4,5) |
| InChIKey | OLXTWQUSGIGELQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 133.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|