C14H14F3NO3 — CID 175094664
1-morpholin-2-yl-4-(2,4,5-trifluorophenyl)butane-1,3-dione (PubChem CID 175094664) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 1-morpholin-2-yl-4-(2,4,5-trifluorophenyl)butane-1,3-dione.
| Compound Name | 1-morpholin-2-yl-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 175094664 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-morpholin-2-yl-4-(2,4,5-trifluorophenyl)butane-1,3-dione |
| SMILES | O=C(CC(=O)C1CNCCO1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H14F3NO3/c15-10-6-12(17)11(16)4-8(10)3-9(19)5-13(20)14-7-18-1-2-21-14/h4,6,14,18H,1-3,5,7H2 |
| InChIKey | VRHXEMZSNHVLLB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|