About cyclooct-5-ene-1,3-dithiol
cyclooct-5-ene-1,3-dithiol (PubChem CID 175095546) has the molecular formula C8H14S2
and a molecular weight of 174.33 g/mol. Its IUPAC name is cyclooct-5-ene-1,3-dithiol.
Molecular Properties
| Compound Name | cyclooct-5-ene-1,3-dithiol |
| PubChem CID | 175095546 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | cyclooct-5-ene-1,3-dithiol |
| SMILES | SC1CC=CCCC(S)C1 |
| InChI | InChI=1S/C8H14S2/c9-7-4-2-1-3-5-8(10)6-7/h1-2,7-10H,3-6H2 |
| InChIKey | RFCCEZLUECMZQU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclooct-5-ene-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooct-5-ene-1,3-dithiol?
The IUPAC name of cyclooct-5-ene-1,3-dithiol (CID 175095546) is cyclooct-5-ene-1,3-dithiol.
What is the SMILES notation for cyclooct-5-ene-1,3-dithiol?
The canonical SMILES for cyclooct-5-ene-1,3-dithiol is SC1CC=CCCC(S)C1.
What is the InChIKey of cyclooct-5-ene-1,3-dithiol?
The InChIKey is RFCCEZLUECMZQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S2/c9-7-4-2-1-3-5-8(10)6-7/h1-2,7-10H,3-6H2.
What are the key properties of cyclooct-5-ene-1,3-dithiol?
cyclooct-5-ene-1,3-dithiol has a molecular weight of 174.33 g/mol, XLogP of 2.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooct-5-ene-1,3-dithiol is sourced from PubChem (CID 175095546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).