About 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane
2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane (PubChem CID 175095632) has the molecular formula C15H32Al2O
and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane.
Molecular Properties
| Compound Name | 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane |
| PubChem CID | 175095632 |
| Molecular Formula | C15H32Al2O |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane |
| SMILES | C=CCC1OC1C.C=CC[AlH2].CC[Al](CC)CC |
| InChI | InChI=1S/C6H10O.C3H5.3C2H5.2Al.2H/c1-3-4-6-5(2)7-6;1-3-2;3*1-2;;;;/h3,5-6H,1,4H2,2H3;3H,1-2H2;3*1H2,2H3;;;; |
| InChIKey | XQRDMRDQQVHISQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane?
The IUPAC name of 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane (CID 175095632) is 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane.
What is the SMILES notation for 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane?
The canonical SMILES for 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane is C=CCC1OC1C.C=CC[AlH2].CC[Al](CC)CC.
What is the InChIKey of 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane?
The InChIKey is XQRDMRDQQVHISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C3H5.3C2H5.2Al.2H/c1-3-4-6-5(2)7-6;1-3-2;3*1-2;;;;/h3,5-6H,1,4H2,2H3;3H,1-2H2;3*1H2,2H3;;;;.
What are the key properties of 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane?
2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane has a molecular weight of 282.38 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-prop-2-enyloxirane;prop-2-enylalumane;triethylalumane is sourced from PubChem (CID 175095632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).