C16H36O6Si3 — CID 175095819
[1-silyl-1,2-bis(trimethylsilyloxy)propyl] 5,6-dihydroxy-2-methylhex-2-enoate (PubChem CID 175095819) has the molecular formula C16H36O6Si3 and a molecular weight of 408.72 g/mol. Its IUPAC name is [1-silyl-1,2-bis(trimethylsilyloxy)propyl] 5,6-dihydroxy-2-methylhex-2-enoate.
| Compound Name | [1-silyl-1,2-bis(trimethylsilyloxy)propyl] 5,6-dihydroxy-2-methylhex-2-enoate |
|---|---|
| PubChem CID | 175095819 |
| Molecular Formula | C16H36O6Si3 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [1-silyl-1,2-bis(trimethylsilyloxy)propyl] 5,6-dihydroxy-2-methylhex-2-enoate |
| SMILES | CC(=CCC(O)CO)C(=O)OC([SiH3])(O[Si](C)(C)C)C(C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H36O6Si3/c1-12(9-10-14(18)11-17)15(19)20-16(23,22-25(6,7)8)13(2)21-24(3,4)5/h9,13-14,17-18H,10-11H2,1-8,23H3 |
| InChIKey | AIASSFHJSNMHOC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|