C4Br3Cl3F4 — CID 175096085
1,2,4-tribromo-1,2,3-trichloro-1,3,4,4-tetrafluorobutane (PubChem CID 175096085) has the molecular formula C4Br3Cl3F4 and a molecular weight of 470.11 g/mol. Its IUPAC name is 1,2,4-tribromo-1,2,3-trichloro-1,3,4,4-tetrafluorobutane.
| Compound Name | 1,2,4-tribromo-1,2,3-trichloro-1,3,4,4-tetrafluorobutane |
|---|---|
| PubChem CID | 175096085 |
| Molecular Formula | C4Br3Cl3F4 |
| Molecular Weight | 470.11 g/mol |
| Exact Mass | 465.66 |
| IUPAC Name | 1,2,4-tribromo-1,2,3-trichloro-1,3,4,4-tetrafluorobutane |
| SMILES | FC(F)(Br)C(F)(Cl)C(Cl)(Br)C(F)(Cl)Br |
| InChI | InChI=1S/C4Br3Cl3F4/c5-1(8,3(6,10)12)2(9,11)4(7,13)14 |
| InChIKey | BZORCSFYEQYINZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.11 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|