C3Br3F3I2 — CID 175096887
1,2,2-tribromo-3,3,3-trifluoro-1,1-diiodopropane (PubChem CID 175096887) has the molecular formula C3Br3F3I2 and a molecular weight of 586.55 g/mol. Its IUPAC name is 1,2,2-tribromo-3,3,3-trifluoro-1,1-diiodopropane.
| Compound Name | 1,2,2-tribromo-3,3,3-trifluoro-1,1-diiodopropane |
|---|---|
| PubChem CID | 175096887 |
| Molecular Formula | C3Br3F3I2 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 583.56 |
| IUPAC Name | 1,2,2-tribromo-3,3,3-trifluoro-1,1-diiodopropane |
| SMILES | FC(F)(F)C(Br)(Br)C(Br)(I)I |
| InChI | InChI=1S/C3Br3F3I2/c4-1(5,2(6,10)11)3(7,8)9 |
| InChIKey | VSLUWIXSZZJWEJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|