C21H32N2O4 — CID 175097056
benzyl 3-methyl-2-[[4-methyl-2-(propanoylamino)pentanoyl]amino]butanoate (PubChem CID 175097056) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is benzyl 3-methyl-2-[[4-methyl-2-(propanoylamino)pentanoyl]amino]butanoate.
| Compound Name | benzyl 3-methyl-2-[[4-methyl-2-(propanoylamino)pentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 175097056 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | benzyl 3-methyl-2-[[4-methyl-2-(propanoylamino)pentanoyl]amino]butanoate |
| SMILES | CCC(=O)NC(CC(C)C)C(=O)NC(C(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C21H32N2O4/c1-6-18(24)22-17(12-14(2)3)20(25)23-19(15(4)5)21(26)27-13-16-10-8-7-9-11-16/h7-11,14-15,17,19H,6,12-13H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | KETCFOSQASSZQG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |