C30H53F2N3O5Si — CID 175097103
(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4,4-difluorooxolan-3-yl)pentadecanoic acid (PubChem CID 175097103) has the molecular formula C30H53F2N3O5Si and a molecular weight of 601.85 g/mol. Its IUPAC name is (2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4,4-difluorooxolan-3-yl)pentadecanoic acid.
| Compound Name | (2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4,4-difluorooxolan-3-yl)pentadecanoic acid |
|---|---|
| PubChem CID | 175097103 |
| Molecular Formula | C30H53F2N3O5Si |
| Molecular Weight | 601.85 g/mol |
| Exact Mass | 601.37 |
| IUPAC Name | (2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(4,4-difluorooxolan-3-yl)pentadecanoic acid |
| SMILES | CCCCCCCCCC[C@H](CC[C@@](CO[Si](C)(C)C(C)(C)C)(C(=O)O)C1COCC1(F)F)n1ccc(N)nc1=O |
| InChI | InChI=1S/C30H53F2N3O5Si/c1-7-8-9-10-11-12-13-14-15-23(35-19-17-25(33)34-27(35)38)16-18-29(26(36)37,24-20-39-22-30(24,31)32)21-40-41(5,6)28(2,3)4/h17,19,23-24H,7-16,18,20-22H2,1-6H3,(H,36,37)(H2,33,34,38)/t23-,24?,29+/m1/s1 |
| InChIKey | IENDOOQIHATCDF-ANFCFGEPSA-N |
| XLogP | 7.05 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.85 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|