C12H12F3N3O5S2 — CID 175097506
2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)spiro[5,6-dihydropyrido[3,4-d]pyrimidine-8,1'-cyclopropane]-7-carboxylic acid (PubChem CID 175097506) has the molecular formula C12H12F3N3O5S2 and a molecular weight of 399.37 g/mol. Its IUPAC name is 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)spiro[5,6-dihydropyrido[3,4-d]pyrimidine-8,1'-cyclopropane]-7-carboxylic acid.
| Compound Name | 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)spiro[5,6-dihydropyrido[3,4-d]pyrimidine-8,1'-cyclopropane]-7-carboxylic acid |
|---|---|
| PubChem CID | 175097506 |
| Molecular Formula | C12H12F3N3O5S2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)spiro[5,6-dihydropyrido[3,4-d]pyrimidine-8,1'-cyclopropane]-7-carboxylic acid |
| SMILES | CSc1nc(OS(=O)(=O)C(F)(F)F)c2c(n1)C1(CC1)N(C(=O)O)CC2 |
| InChI | InChI=1S/C12H12F3N3O5S2/c1-24-9-16-7-6(2-5-18(10(19)20)11(7)3-4-11)8(17-9)23-25(21,22)12(13,14)15/h2-5H2,1H3,(H,19,20) |
| InChIKey | OYELCEOFTDXZCL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|