C14H17N5O3S — CID 175097538
N'-[2-(1,3-benzoxazol-2-yl)ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonohydrazide (PubChem CID 175097538) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-yl)ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonohydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-yl)ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonohydrazide |
|---|---|
| PubChem CID | 175097538 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-yl)ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonohydrazide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NNCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H17N5O3S/c1-9-14(10(2)18-17-9)23(20,21)19-15-8-7-13-16-11-5-3-4-6-12(11)22-13/h3-6,15,19H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | OMZGXUQXPORGQX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|