About 2,3-dipyridin-3-ylpyridine;1,3-oxazole
2,3-dipyridin-3-ylpyridine;1,3-oxazole (PubChem CID 175098122) has the molecular formula C18H14N4O
and a molecular weight of 302.34 g/mol. Its IUPAC name is 2,3-dipyridin-3-ylpyridine;1,3-oxazole.
Molecular Properties
| Compound Name | 2,3-dipyridin-3-ylpyridine;1,3-oxazole |
| PubChem CID | 175098122 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2,3-dipyridin-3-ylpyridine;1,3-oxazole |
| SMILES | c1cncc(-c2cccnc2-c2cccnc2)c1.c1cocn1 |
| InChI | InChI=1S/C15H11N3.C3H3NO/c1-4-12(10-16-7-1)14-6-3-9-18-15(14)13-5-2-8-17-11-13;1-2-5-3-4-1/h1-11H;1-3H |
| InChIKey | RHTMXACCAYSJRT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dipyridin-3-ylpyridine;1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dipyridin-3-ylpyridine;1,3-oxazole?
The IUPAC name of 2,3-dipyridin-3-ylpyridine;1,3-oxazole (CID 175098122) is 2,3-dipyridin-3-ylpyridine;1,3-oxazole.
What is the SMILES notation for 2,3-dipyridin-3-ylpyridine;1,3-oxazole?
The canonical SMILES for 2,3-dipyridin-3-ylpyridine;1,3-oxazole is c1cncc(-c2cccnc2-c2cccnc2)c1.c1cocn1.
What is the InChIKey of 2,3-dipyridin-3-ylpyridine;1,3-oxazole?
The InChIKey is RHTMXACCAYSJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3.C3H3NO/c1-4-12(10-16-7-1)14-6-3-9-18-15(14)13-5-2-8-17-11-13;1-2-5-3-4-1/h1-11H;1-3H.
What are the key properties of 2,3-dipyridin-3-ylpyridine;1,3-oxazole?
2,3-dipyridin-3-ylpyridine;1,3-oxazole has a molecular weight of 302.34 g/mol, XLogP of 3.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dipyridin-3-ylpyridine;1,3-oxazole is sourced from PubChem (CID 175098122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).