C4Br2Cl3F5 — CID 175098478
1,1-dibromo-1,2,2-trichloro-3,3,4,4,4-pentafluorobutane (PubChem CID 175098478) has the molecular formula C4Br2Cl3F5 and a molecular weight of 409.20 g/mol. Its IUPAC name is 1,1-dibromo-1,2,2-trichloro-3,3,4,4,4-pentafluorobutane.
| Compound Name | 1,1-dibromo-1,2,2-trichloro-3,3,4,4,4-pentafluorobutane |
|---|---|
| PubChem CID | 175098478 |
| Molecular Formula | C4Br2Cl3F5 |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 405.74 |
| IUPAC Name | 1,1-dibromo-1,2,2-trichloro-3,3,4,4,4-pentafluorobutane |
| SMILES | FC(F)(F)C(F)(F)C(Cl)(Cl)C(Cl)(Br)Br |
| InChI | InChI=1S/C4Br2Cl3F5/c5-3(6,9)1(7,8)2(10,11)4(12,13)14 |
| InChIKey | LABMMAZJEHMQKJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|