[2-(phenoxymethyl)thiophen-3-yl]boronic acid

C11H11BO3S — CID 175098707

IUPAC[2-(phenoxymethyl)thiophen-3-yl]boronic acid
SMILESOB(O)c1ccsc1COc1ccccc1
InChIInChI=1S/C11H11BO3S/c13-12(14)10-6-7-16-11(10)8-15-9-4-2-1-3-5-9/h1-7,13-14H,8H2
InChIKeyXBEQSSDXVILAAF-UHFFFAOYSA-N
MW234.09 g/mol
LogP1.01
Rot. Bonds4

About [2-(phenoxymethyl)thiophen-3-yl]boronic acid

[2-(phenoxymethyl)thiophen-3-yl]boronic acid (PubChem CID 175098707) has the molecular formula C11H11BO3S and a molecular weight of 234.09 g/mol. Its IUPAC name is [2-(phenoxymethyl)thiophen-3-yl]boronic acid.

Molecular Properties

Compound Name[2-(phenoxymethyl)thiophen-3-yl]boronic acid
PubChem CID175098707
Molecular FormulaC11H11BO3S
Molecular Weight234.09 g/mol
Exact Mass234.05
IUPAC Name[2-(phenoxymethyl)thiophen-3-yl]boronic acid
SMILESOB(O)c1ccsc1COc1ccccc1
InChIInChI=1S/C11H11BO3S/c13-12(14)10-6-7-16-11(10)8-15-9-4-2-1-3-5-9/h1-7,13-14H,8H2
InChIKeyXBEQSSDXVILAAF-UHFFFAOYSA-N
XLogP1.01
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.09
LogP ≤ 51.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-(phenoxymethyl)thiophen-3-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(phenoxymethyl)thiophen-3-yl]boronic acid?
The IUPAC name of [2-(phenoxymethyl)thiophen-3-yl]boronic acid (CID 175098707) is [2-(phenoxymethyl)thiophen-3-yl]boronic acid.
What is the SMILES notation for [2-(phenoxymethyl)thiophen-3-yl]boronic acid?
The canonical SMILES for [2-(phenoxymethyl)thiophen-3-yl]boronic acid is OB(O)c1ccsc1COc1ccccc1.
What is the InChIKey of [2-(phenoxymethyl)thiophen-3-yl]boronic acid?
The InChIKey is XBEQSSDXVILAAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BO3S/c13-12(14)10-6-7-16-11(10)8-15-9-4-2-1-3-5-9/h1-7,13-14H,8H2.
What are the key properties of [2-(phenoxymethyl)thiophen-3-yl]boronic acid?
[2-(phenoxymethyl)thiophen-3-yl]boronic acid has a molecular weight of 234.09 g/mol, XLogP of 1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(phenoxymethyl)thiophen-3-yl]boronic acid is sourced from PubChem (CID 175098707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).