About sodium;pentane;azide
sodium;pentane;azide (PubChem CID 175098930) has the molecular formula C5H12N3Na
and a molecular weight of 137.16 g/mol. Its IUPAC name is sodium;pentane;azide.
Molecular Properties
| Compound Name | sodium;pentane;azide |
| PubChem CID | 175098930 |
| Molecular Formula | C5H12N3Na |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.09 |
| IUPAC Name | sodium;pentane;azide |
| SMILES | CCCCC.[N-]=[N+]=[N-].[Na+] |
| InChI | InChI=1S/C5H12.N3.Na/c1-3-5-4-2;1-3-2;/h3-5H2,1-2H3;;/q;-1;+1 |
| InChIKey | YQHQKALYJDXIAP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze sodium;pentane;azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;pentane;azide?
The IUPAC name of sodium;pentane;azide (CID 175098930) is sodium;pentane;azide.
What is the SMILES notation for sodium;pentane;azide?
The canonical SMILES for sodium;pentane;azide is CCCCC.[N-]=[N+]=[N-].[Na+].
What is the InChIKey of sodium;pentane;azide?
The InChIKey is YQHQKALYJDXIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.N3.Na/c1-3-5-4-2;1-3-2;/h3-5H2,1-2H3;;/q;-1;+1.
What are the key properties of sodium;pentane;azide?
sodium;pentane;azide has a molecular weight of 137.16 g/mol, XLogP of 0.07, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;pentane;azide is sourced from PubChem (CID 175098930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).