C11H8F11NO2 — CID 175098965
2,4,4,5,5,6,6,6-octafluoro-N-methyl-3-oxo-N-prop-2-enyl-2-(trifluoromethyl)hexanamide (PubChem CID 175098965) has the molecular formula C11H8F11NO2 and a molecular weight of 395.17 g/mol. Its IUPAC name is 2,4,4,5,5,6,6,6-octafluoro-N-methyl-3-oxo-N-prop-2-enyl-2-(trifluoromethyl)hexanamide.
| Compound Name | 2,4,4,5,5,6,6,6-octafluoro-N-methyl-3-oxo-N-prop-2-enyl-2-(trifluoromethyl)hexanamide |
|---|---|
| PubChem CID | 175098965 |
| Molecular Formula | C11H8F11NO2 |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2,4,4,5,5,6,6,6-octafluoro-N-methyl-3-oxo-N-prop-2-enyl-2-(trifluoromethyl)hexanamide |
| SMILES | C=CCN(C)C(=O)C(F)(C(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F11NO2/c1-3-4-23(2)6(25)7(12,10(17,18)19)5(24)8(13,14)9(15,16)11(20,21)22/h3H,1,4H2,2H3 |
| InChIKey | BKZARULCJJNKCG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|