C11H11F8NO2 — CID 175098966
2,4,4,5,5,6,6,6-octafluoro-N,2-dimethyl-3-oxo-N-prop-2-enylhexanamide (PubChem CID 175098966) has the molecular formula C11H11F8NO2 and a molecular weight of 341.20 g/mol. Its IUPAC name is 2,4,4,5,5,6,6,6-octafluoro-N,2-dimethyl-3-oxo-N-prop-2-enylhexanamide.
| Compound Name | 2,4,4,5,5,6,6,6-octafluoro-N,2-dimethyl-3-oxo-N-prop-2-enylhexanamide |
|---|---|
| PubChem CID | 175098966 |
| Molecular Formula | C11H11F8NO2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2,4,4,5,5,6,6,6-octafluoro-N,2-dimethyl-3-oxo-N-prop-2-enylhexanamide |
| SMILES | C=CCN(C)C(=O)C(C)(F)C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F8NO2/c1-4-5-20(3)7(22)8(2,12)6(21)9(13,14)10(15,16)11(17,18)19/h4H,1,5H2,2-3H3 |
| InChIKey | PGNGEFRMEQDGHL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|