About 2H-3,1,2-benzoxazaphosphinine
2H-3,1,2-benzoxazaphosphinine (PubChem CID 175098968) has the molecular formula C7H6NOP
and a molecular weight of 151.10 g/mol. Its IUPAC name is 2H-3,1,2-benzoxazaphosphinine.
Molecular Properties
| Compound Name | 2H-3,1,2-benzoxazaphosphinine |
| PubChem CID | 175098968 |
| Molecular Formula | C7H6NOP |
| Molecular Weight | 151.10 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 2H-3,1,2-benzoxazaphosphinine |
| SMILES | C1=c2ccccc2=NPO1 |
| InChI | InChI=1S/C7H6NOP/c1-2-4-7-6(3-1)5-9-10-8-7/h1-5,10H |
| InChIKey | UWLTVDQNCZIOCJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.10 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2H-3,1,2-benzoxazaphosphinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-3,1,2-benzoxazaphosphinine?
The IUPAC name of 2H-3,1,2-benzoxazaphosphinine (CID 175098968) is 2H-3,1,2-benzoxazaphosphinine.
What is the SMILES notation for 2H-3,1,2-benzoxazaphosphinine?
The canonical SMILES for 2H-3,1,2-benzoxazaphosphinine is C1=c2ccccc2=NPO1.
What is the InChIKey of 2H-3,1,2-benzoxazaphosphinine?
The InChIKey is UWLTVDQNCZIOCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6NOP/c1-2-4-7-6(3-1)5-9-10-8-7/h1-5,10H.
What are the key properties of 2H-3,1,2-benzoxazaphosphinine?
2H-3,1,2-benzoxazaphosphinine has a molecular weight of 151.10 g/mol, XLogP of 0.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-3,1,2-benzoxazaphosphinine is sourced from PubChem (CID 175098968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).