C10H19N2P — CID 175101128
azane;phosphane;6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine (PubChem CID 175101128) has the molecular formula C10H19N2P and a molecular weight of 198.25 g/mol. Its IUPAC name is azane;phosphane;6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine.
| Compound Name | azane;phosphane;6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 175101128 |
| Molecular Formula | C10H19N2P |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | azane;phosphane;6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine |
| SMILES | N.P.c1cnc2c(c1)CCCCC2 |
| InChI | InChI=1S/C10H13N.H3N.H3P/c1-2-5-9-6-4-8-11-10(9)7-3-1;;/h4,6,8H,1-3,5,7H2;2*1H3 |
| InChIKey | CHIIROCQYAQDPN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|