C20H34O7 — CID 175101146
9-hydroxy-7,11-dioxo-2,5-dipentyl-1,6-dioxacycloundecane-9-carboxylic acid (PubChem CID 175101146) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is 9-hydroxy-7,11-dioxo-2,5-dipentyl-1,6-dioxacycloundecane-9-carboxylic acid.
| Compound Name | 9-hydroxy-7,11-dioxo-2,5-dipentyl-1,6-dioxacycloundecane-9-carboxylic acid |
|---|---|
| PubChem CID | 175101146 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 9-hydroxy-7,11-dioxo-2,5-dipentyl-1,6-dioxacycloundecane-9-carboxylic acid |
| SMILES | CCCCCC1CCC(CCCCC)OC(=O)CC(O)(C(=O)O)CC(=O)O1 |
| InChI | InChI=1S/C20H34O7/c1-3-5-7-9-15-11-12-16(10-8-6-4-2)27-18(22)14-20(25,19(23)24)13-17(21)26-15/h15-16,25H,3-14H2,1-2H3,(H,23,24) |
| InChIKey | HLBKTGBANJNMBY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|