About (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane
(4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane (PubChem CID 175101259) has the molecular formula C10H9F7S
and a molecular weight of 294.24 g/mol. Its IUPAC name is (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane.
Molecular Properties
| Compound Name | (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane |
| PubChem CID | 175101259 |
| Molecular Formula | C10H9F7S |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane |
| SMILES | C=CC1=CCC(=CS(F)(F)(F)(F)C(F)(F)F)C=C1 |
| InChI | InChI=1S/C10H9F7S/c1-2-8-3-5-9(6-4-8)7-18(14,15,16,17)10(11,12)13/h2-5,7H,1,6H2 |
| InChIKey | QGCZIGXSYJNQPB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane?
The IUPAC name of (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane (CID 175101259) is (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane.
What is the SMILES notation for (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane?
The canonical SMILES for (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane is C=CC1=CCC(=CS(F)(F)(F)(F)C(F)(F)F)C=C1.
What is the InChIKey of (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane?
The InChIKey is QGCZIGXSYJNQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F7S/c1-2-8-3-5-9(6-4-8)7-18(14,15,16,17)10(11,12)13/h2-5,7H,1,6H2.
What are the key properties of (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane?
(4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane has a molecular weight of 294.24 g/mol, XLogP of 5.88, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylcyclohexa-2,4-dien-1-ylidene)methyl-tetrafluoro-(trifluoromethyl)-λ6-sulfane is sourced from PubChem (CID 175101259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).