About 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea
1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea (PubChem CID 175101455) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea.
Molecular Properties
| Compound Name | 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea |
| PubChem CID | 175101455 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea |
| SMILES | C=CN(C=C)C(=O)N(CO)CO |
| InChI | InChI=1S/C7H12N2O3/c1-3-8(4-2)7(12)9(5-10)6-11/h3-4,10-11H,1-2,5-6H2 |
| InChIKey | ZFGZMDWYHORPCW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea?
The IUPAC name of 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea (CID 175101455) is 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea.
What is the SMILES notation for 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea?
The canonical SMILES for 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea is C=CN(C=C)C(=O)N(CO)CO.
What is the InChIKey of 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea?
The InChIKey is ZFGZMDWYHORPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-3-8(4-2)7(12)9(5-10)6-11/h3-4,10-11H,1-2,5-6H2.
What are the key properties of 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea?
1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea has a molecular weight of 172.18 g/mol, XLogP of -0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(ethenyl)-3,3-bis(hydroxymethyl)urea is sourced from PubChem (CID 175101455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).