About [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate
[2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate (PubChem CID 175101712) has the molecular formula C8H8O8
and a molecular weight of 232.14 g/mol. Its IUPAC name is [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate.
Molecular Properties
| Compound Name | [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate |
| PubChem CID | 175101712 |
| Molecular Formula | C8H8O8 |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate |
| SMILES | O.O.O.O.O=C=C1C(=C=O)C(=C=O)C1=C=O |
| InChI | InChI=1S/C8O4.4H2O/c9-1-5-6(2-10)8(4-12)7(5)3-11;;;;/h;4*1H2 |
| InChIKey | GXQZZWKTQRRWQZ-UHFFFAOYSA-N |
| XLogP | -4.27 |
| TPSA | 194.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | -4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate?
The IUPAC name of [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate (CID 175101712) is [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate.
What is the SMILES notation for [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate?
The canonical SMILES for [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate is O.O.O.O.O=C=C1C(=C=O)C(=C=O)C1=C=O.
What is the InChIKey of [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate?
The InChIKey is GXQZZWKTQRRWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8O4.4H2O/c9-1-5-6(2-10)8(4-12)7(5)3-11;;;;/h;4*1H2.
What are the key properties of [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate?
[2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate has a molecular weight of 232.14 g/mol, XLogP of -4.27, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3,4-tris(oxomethylidene)cyclobutylidene]methanone;tetrahydrate is sourced from PubChem (CID 175101712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).